C9H14ClN3O2 — CID 102698939
4-chloro-5-(2-methoxypropylamino)-2-methylpyridazin-3-one (PubChem CID 102698939) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is 4-chloro-5-(2-methoxypropylamino)-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-(2-methoxypropylamino)-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 102698939 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-chloro-5-(2-methoxypropylamino)-2-methylpyridazin-3-one |
| SMILES | COC(C)CNc1cnn(C)c(=O)c1Cl |
| InChI | InChI=1S/C9H14ClN3O2/c1-6(15-3)4-11-7-5-12-13(2)9(14)8(7)10/h5-6,11H,4H2,1-3H3 |
| InChIKey | KNUIEQOPXMULNK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |