C9H15ClN4O2 — CID 114445572
5-[(2-amino-3-hydroxybutyl)amino]-4-chloro-2-methylpyridazin-3-one (PubChem CID 114445572) has the molecular formula C9H15ClN4O2 and a molecular weight of 246.70 g/mol. Its IUPAC name is 5-[(2-amino-3-hydroxybutyl)amino]-4-chloro-2-methylpyridazin-3-one.
| Compound Name | 5-[(2-amino-3-hydroxybutyl)amino]-4-chloro-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 114445572 |
| Molecular Formula | C9H15ClN4O2 |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-[(2-amino-3-hydroxybutyl)amino]-4-chloro-2-methylpyridazin-3-one |
| SMILES | CC(O)C(N)CNc1cnn(C)c(=O)c1Cl |
| InChI | InChI=1S/C9H15ClN4O2/c1-5(15)6(11)3-12-7-4-13-14(2)9(16)8(7)10/h4-6,12,15H,3,11H2,1-2H3 |
| InChIKey | PUGNJEYNIOYGIY-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |