C14H16ClN3O — CID 115644108
4-chloro-5-[(2-ethylphenyl)methylamino]-2-methylpyridazin-3-one (PubChem CID 115644108) has the molecular formula C14H16ClN3O and a molecular weight of 277.76 g/mol. Its IUPAC name is 4-chloro-5-[(2-ethylphenyl)methylamino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(2-ethylphenyl)methylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 115644108 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-chloro-5-[(2-ethylphenyl)methylamino]-2-methylpyridazin-3-one |
| SMILES | CCc1ccccc1CNc1cnn(C)c(=O)c1Cl |
| InChI | InChI=1S/C14H16ClN3O/c1-3-10-6-4-5-7-11(10)8-16-12-9-17-18(2)14(19)13(12)15/h4-7,9,16H,3,8H2,1-2H3 |
| InChIKey | ANLLJBVAXCVQOU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |