C7H8ClN7O — CID 115621009
4-chloro-2-methyl-5-(2H-tetrazol-5-ylmethylamino)pyridazin-3-one (PubChem CID 115621009) has the molecular formula C7H8ClN7O and a molecular weight of 241.64 g/mol. Its IUPAC name is 4-chloro-2-methyl-5-(2H-tetrazol-5-ylmethylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-methyl-5-(2H-tetrazol-5-ylmethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 115621009 |
| Molecular Formula | C7H8ClN7O |
| Molecular Weight | 241.64 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-chloro-2-methyl-5-(2H-tetrazol-5-ylmethylamino)pyridazin-3-one |
| SMILES | Cn1ncc(NCc2nn[nH]n2)c(Cl)c1=O |
| InChI | InChI=1S/C7H8ClN7O/c1-15-7(16)6(8)4(2-10-15)9-3-5-11-13-14-12-5/h2,9H,3H2,1H3,(H,11,12,13,14) |
| InChIKey | WESFQQPAKJVAOZ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.64 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |