C14H17ClN4O — CID 114444517
5-[[4-(2-aminoethyl)phenyl]methylamino]-4-chloro-2-methylpyridazin-3-one (PubChem CID 114444517) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 5-[[4-(2-aminoethyl)phenyl]methylamino]-4-chloro-2-methylpyridazin-3-one.
| Compound Name | 5-[[4-(2-aminoethyl)phenyl]methylamino]-4-chloro-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 114444517 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 5-[[4-(2-aminoethyl)phenyl]methylamino]-4-chloro-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NCc2ccc(CCN)cc2)c(Cl)c1=O |
| InChI | InChI=1S/C14H17ClN4O/c1-19-14(20)13(15)12(9-18-19)17-8-11-4-2-10(3-5-11)6-7-16/h2-5,9,17H,6-8,16H2,1H3 |
| InChIKey | JNEFXJVHKDUBKY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |