C14H15N5O3 — CID 53237483
4-[6-(furan-2-ylmethylamino)purin-9-yl]butanoic acid (PubChem CID 53237483) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 4-[6-(furan-2-ylmethylamino)purin-9-yl]butanoic acid.
| Compound Name | 4-[6-(furan-2-ylmethylamino)purin-9-yl]butanoic acid |
|---|---|
| PubChem CID | 53237483 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-[6-(furan-2-ylmethylamino)purin-9-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cnc2c(NCc3ccco3)ncnc21 |
| InChI | InChI=1S/C14H15N5O3/c20-11(21)4-1-5-19-9-18-12-13(16-8-17-14(12)19)15-7-10-3-2-6-22-10/h2-3,6,8-9H,1,4-5,7H2,(H,20,21)(H,15,16,17) |
| InChIKey | VSPRQLJWOCQEED-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |