C20H14ClN5O3 — CID 155811641
6-chloro-4-[[6-(furan-2-ylmethylamino)purin-9-yl]methyl]chromen-2-one (PubChem CID 155811641) has the molecular formula C20H14ClN5O3 and a molecular weight of 407.82 g/mol. Its IUPAC name is 6-chloro-4-[[6-(furan-2-ylmethylamino)purin-9-yl]methyl]chromen-2-one.
| Compound Name | 6-chloro-4-[[6-(furan-2-ylmethylamino)purin-9-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 155811641 |
| Molecular Formula | C20H14ClN5O3 |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 6-chloro-4-[[6-(furan-2-ylmethylamino)purin-9-yl]methyl]chromen-2-one |
| SMILES | O=c1cc(Cn2cnc3c(NCc4ccco4)ncnc32)c2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C20H14ClN5O3/c21-13-3-4-16-15(7-13)12(6-17(27)29-16)9-26-11-25-18-19(23-10-24-20(18)26)22-8-14-2-1-5-28-14/h1-7,10-11H,8-9H2,(H,22,23,24) |
| InChIKey | BFBJDDBKQKEMBY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|