C18H23N5O3Si — CID 10524145
N-[9-[3-[bis(hydroxymethyl)-methylsilyl]propyl]purin-6-yl]benzamide (PubChem CID 10524145) has the molecular formula C18H23N5O3Si and a molecular weight of 385.50 g/mol. Its IUPAC name is N-[9-[3-[bis(hydroxymethyl)-methylsilyl]propyl]purin-6-yl]benzamide.
| Compound Name | N-[9-[3-[bis(hydroxymethyl)-methylsilyl]propyl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 10524145 |
| Molecular Formula | C18H23N5O3Si |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[9-[3-[bis(hydroxymethyl)-methylsilyl]propyl]purin-6-yl]benzamide |
| SMILES | C[Si](CO)(CO)CCCn1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C18H23N5O3Si/c1-27(12-24,13-25)9-5-8-23-11-21-15-16(19-10-20-17(15)23)22-18(26)14-6-3-2-4-7-14/h2-4,6-7,10-11,24-25H,5,8-9,12-13H2,1H3,(H,19,20,22,26) |
| InChIKey | XATBDWQLAZPNCL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|