C19H23N5O — CID 174164210
N-[9-(3-methylhexan-3-yl)purin-6-yl]benzamide (PubChem CID 174164210) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is N-[9-(3-methylhexan-3-yl)purin-6-yl]benzamide.
| Compound Name | N-[9-(3-methylhexan-3-yl)purin-6-yl]benzamide |
|---|---|
| PubChem CID | 174164210 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-[9-(3-methylhexan-3-yl)purin-6-yl]benzamide |
| SMILES | CCCC(C)(CC)n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C19H23N5O/c1-4-11-19(3,5-2)24-13-22-15-16(20-12-21-17(15)24)23-18(25)14-9-7-6-8-10-14/h6-10,12-13H,4-5,11H2,1-3H3,(H,20,21,23,25) |
| InChIKey | YISLHKJKLOSVNF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |