C25H19N5O2 — CID 118131405
(9-tritylpurin-6-yl)carbamic acid (PubChem CID 118131405) has the molecular formula C25H19N5O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is (9-tritylpurin-6-yl)carbamic acid.
| Compound Name | (9-tritylpurin-6-yl)carbamic acid |
|---|---|
| PubChem CID | 118131405 |
| Molecular Formula | C25H19N5O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (9-tritylpurin-6-yl)carbamic acid |
| SMILES | O=C(O)Nc1ncnc2c1ncn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19N5O2/c31-24(32)29-22-21-23(27-16-26-22)30(17-28-21)25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H,(H,31,32)(H,26,27,29) |
| InChIKey | SBDGSWGSTWHTQO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|