C21H19N5O2 — CID 70011748
methyl 6-(2,2-diphenylethylamino)purine-9-carboxylate (PubChem CID 70011748) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is methyl 6-(2,2-diphenylethylamino)purine-9-carboxylate.
| Compound Name | methyl 6-(2,2-diphenylethylamino)purine-9-carboxylate |
|---|---|
| PubChem CID | 70011748 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | methyl 6-(2,2-diphenylethylamino)purine-9-carboxylate |
| SMILES | COC(=O)n1cnc2c(NCC(c3ccccc3)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C21H19N5O2/c1-28-21(27)26-14-25-18-19(23-13-24-20(18)26)22-12-17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,13-14,17H,12H2,1H3,(H,22,23,24) |
| InChIKey | GAKXFIZADQDOHO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |