C32H37N9O5 — CID 67553033
(2S,3R,4R,5R)-5-amino-5-[6-(2,2-diphenylethylamino)purin-9-yl]oxy-N-ethyl-3,4-dihydroxy-4-[2-(1-methylimidazol-4-yl)ethyl]oxolane-2-carboxamide (PubChem CID 67553033) has the molecular formula C32H37N9O5 and a molecular weight of 627.71 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-amino-5-[6-(2,2-diphenylethylamino)purin-9-yl]oxy-N-ethyl-3,4-dihydroxy-4-[2-(1-methylimidazol-4-yl)ethyl]oxolane-2-carboxamide.
| Compound Name | (2S,3R,4R,5R)-5-amino-5-[6-(2,2-diphenylethylamino)purin-9-yl]oxy-N-ethyl-3,4-dihydroxy-4-[2-(1-methylimidazol-4-yl)ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 67553033 |
| Molecular Formula | C32H37N9O5 |
| Molecular Weight | 627.71 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | (2S,3R,4R,5R)-5-amino-5-[6-(2,2-diphenylethylamino)purin-9-yl]oxy-N-ethyl-3,4-dihydroxy-4-[2-(1-methylimidazol-4-yl)ethyl]oxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@](N)(On2cnc3c(NCC(c4ccccc4)c4ccccc4)ncnc32)[C@@](O)(CCc2cn(C)cn2)[C@@H]1O |
| InChI | InChI=1S/C32H37N9O5/c1-3-34-30(43)26-27(42)31(44,15-14-23-17-40(2)19-38-23)32(33,45-26)46-41-20-39-25-28(36-18-37-29(25)41)35-16-24(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-13,17-20,24,26-27,42,44H,3,14-16,33H2,1-2H3,(H,34,43)(H,35,36,37)/t26-,27+,31+,32+/m0/s1 |
| InChIKey | JMSOMYCGQFKEET-BZOYJHAOSA-N |
| XLogP | 1.10 |
| TPSA | 187.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.71 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|