C40H35IN6O6 — CID 22972468
[4-benzoyloxy-5-[6-(2,2-diphenylethylamino)-2-iodopurin-9-yl]-2-(ethylcarbamoyl)oxolan-3-yl] benzoate (PubChem CID 22972468) has the molecular formula C40H35IN6O6 and a molecular weight of 822.66 g/mol. Its IUPAC name is [4-benzoyloxy-5-[6-(2,2-diphenylethylamino)-2-iodopurin-9-yl]-2-(ethylcarbamoyl)oxolan-3-yl] benzoate.
| Compound Name | [4-benzoyloxy-5-[6-(2,2-diphenylethylamino)-2-iodopurin-9-yl]-2-(ethylcarbamoyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 22972468 |
| Molecular Formula | C40H35IN6O6 |
| Molecular Weight | 822.66 g/mol |
| Exact Mass | 822.17 |
| IUPAC Name | [4-benzoyloxy-5-[6-(2,2-diphenylethylamino)-2-iodopurin-9-yl]-2-(ethylcarbamoyl)oxolan-3-yl] benzoate |
| SMILES | CCNC(=O)C1OC(n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(I)nc32)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H35IN6O6/c1-2-42-36(48)32-31(52-38(49)27-19-11-5-12-20-27)33(53-39(50)28-21-13-6-14-22-28)37(51-32)47-24-44-30-34(45-40(41)46-35(30)47)43-23-29(25-15-7-3-8-16-25)26-17-9-4-10-18-26/h3-22,24,29,31-33,37H,2,23H2,1H3,(H,42,48)(H,43,45,46) |
| InChIKey | CMVOGQJQDXJVND-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 146.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|