C30H36N8O6 — CID 70347394
(2S,3S,4R,5S)-5-[6-(2,2-diphenylethylamino)-2-[(4-hydroxypyrrolidin-3-yl)amino]purin-9-yl]oxy-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 70347394) has the molecular formula C30H36N8O6 and a molecular weight of 604.67 g/mol. Its IUPAC name is (2S,3S,4R,5S)-5-[6-(2,2-diphenylethylamino)-2-[(4-hydroxypyrrolidin-3-yl)amino]purin-9-yl]oxy-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5S)-5-[6-(2,2-diphenylethylamino)-2-[(4-hydroxypyrrolidin-3-yl)amino]purin-9-yl]oxy-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 70347394 |
| Molecular Formula | C30H36N8O6 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | (2S,3S,4R,5S)-5-[6-(2,2-diphenylethylamino)-2-[(4-hydroxypyrrolidin-3-yl)amino]purin-9-yl]oxy-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](On2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NC4CNCC4O)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H36N8O6/c1-2-32-28(42)25-23(40)24(41)29(43-25)44-38-16-34-22-26(36-30(37-27(22)38)35-20-14-31-15-21(20)39)33-13-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19-21,23-25,29,31,39-41H,2,13-15H2,1H3,(H,32,42)(H2,33,35,36,37)/t20?,21?,23-,24+,25-,29-/m0/s1 |
| InChIKey | DWCOJGBZYPNFDT-XRHCHHEFSA-N |
| XLogP | -0.17 |
| TPSA | 187.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |