C21H26N6O3 — CID 44601542
methyl (2S)-2-[[2-[6-(benzylamino)purin-9-yl]acetyl]amino]-4-methylpentanoate (PubChem CID 44601542) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[6-(benzylamino)purin-9-yl]acetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[2-[6-(benzylamino)purin-9-yl]acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 44601542 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | methyl (2S)-2-[[2-[6-(benzylamino)purin-9-yl]acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)Cn1cnc2c(NCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C21H26N6O3/c1-14(2)9-16(21(29)30-3)26-17(28)11-27-13-25-18-19(23-12-24-20(18)27)22-10-15-7-5-4-6-8-15/h4-8,12-14,16H,9-11H2,1-3H3,(H,26,28)(H,22,23,24)/t16-/m0/s1 |
| InChIKey | BAPNXWBXRRKXSK-INIZCTEOSA-N |
| XLogP | 2.14 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |