C20H25N9O4 — CID 11798027
(2S)-3-[6-[3-(diaminomethylideneamino)propylamino]purin-9-yl]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 11798027) has the molecular formula C20H25N9O4 and a molecular weight of 455.48 g/mol. Its IUPAC name is (2S)-3-[6-[3-(diaminomethylideneamino)propylamino]purin-9-yl]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-[6-[3-(diaminomethylideneamino)propylamino]purin-9-yl]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 11798027 |
| Molecular Formula | C20H25N9O4 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (2S)-3-[6-[3-(diaminomethylideneamino)propylamino]purin-9-yl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | NC(N)=NCCCNc1ncnc2c1ncn2C[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H25N9O4/c21-19(22)24-8-4-7-23-16-15-17(26-11-25-16)29(12-27-15)9-14(18(30)31)28-20(32)33-10-13-5-2-1-3-6-13/h1-3,5-6,11-12,14H,4,7-10H2,(H,28,32)(H,30,31)(H4,21,22,24)(H,23,25,26)/t14-/m0/s1 |
| InChIKey | ZSZGVSAKPBFUTO-AWEZNQCLSA-N |
| XLogP | 0.28 |
| TPSA | 195.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|