C36H44CuN12O4 — CID 10462883
bis((2S)-2-amino-6-[(9-benzylpurin-6-yl)amino]hexanoic acid);copper (PubChem CID 10462883) has the molecular formula C36H44CuN12O4 and a molecular weight of 772.37 g/mol. Its IUPAC name is bis((2S)-2-amino-6-[(9-benzylpurin-6-yl)amino]hexanoic acid);copper.
| Compound Name | bis((2S)-2-amino-6-[(9-benzylpurin-6-yl)amino]hexanoic acid);copper |
|---|---|
| PubChem CID | 10462883 |
| Molecular Formula | C36H44CuN12O4 |
| Molecular Weight | 772.37 g/mol |
| Exact Mass | 771.29 |
| IUPAC Name | bis((2S)-2-amino-6-[(9-benzylpurin-6-yl)amino]hexanoic acid);copper |
| SMILES | N[C@@H](CCCCNc1ncnc2c1ncn2Cc1ccccc1)C(=O)O.N[C@@H](CCCCNc1ncnc2c1ncn2Cc1ccccc1)C(=O)O.[Cu] |
| InChI | InChI=1S/2C18H22N6O2.Cu/c2*19-14(18(25)26)8-4-5-9-20-16-15-17(22-11-21-16)24(12-23-15)10-13-6-2-1-3-7-13;/h2*1-3,6-7,11-12,14H,4-5,8-10,19H2,(H,25,26)(H,20,21,22);/t2*14-;/m00./s1 |
| InChIKey | OYBVSKGUVKREQO-VJOCCTOCSA-N |
| XLogP | 3.73 |
| TPSA | 237.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|