C18H20N4O2 — CID 101351358
(9-benzylpurin-6-yl)methyl 2,2-dimethylpropanoate (PubChem CID 101351358) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (9-benzylpurin-6-yl)methyl 2,2-dimethylpropanoate.
| Compound Name | (9-benzylpurin-6-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101351358 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (9-benzylpurin-6-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ncnc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C18H20N4O2/c1-18(2,3)17(23)24-10-14-15-16(20-11-19-14)22(12-21-15)9-13-7-5-4-6-8-13/h4-8,11-12H,9-10H2,1-3H3 |
| InChIKey | ZREIBMKBAVTHSW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |