C16H14N4O2 — CID 24895799
trans-(1S,2S)-2-(9-benzylpurin-6-yl)cyclopropane-1-carboxylic acid (PubChem CID 24895799) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is trans-(1S,2S)-2-(9-benzylpurin-6-yl)cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-(9-benzylpurin-6-yl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 24895799 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | trans-(1S,2S)-2-(9-benzylpurin-6-yl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H]1c1ncnc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C16H14N4O2/c21-16(22)12-6-11(12)13-14-15(18-8-17-13)20(9-19-14)7-10-4-2-1-3-5-10/h1-5,8-9,11-12H,6-7H2,(H,21,22)/t11-,12-/m0/s1 |
| InChIKey | ZIESFYWLQJEFGK-RYUDHWBXSA-N |
| XLogP | 2.06 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |