C23H22ClN5O2 — CID 154717362
tert-butyl N-[2-(9-benzylpurin-6-yl)-5-chlorophenyl]carbamate (PubChem CID 154717362) has the molecular formula C23H22ClN5O2 and a molecular weight of 435.92 g/mol. Its IUPAC name is tert-butyl N-[2-(9-benzylpurin-6-yl)-5-chlorophenyl]carbamate.
| Compound Name | tert-butyl N-[2-(9-benzylpurin-6-yl)-5-chlorophenyl]carbamate |
|---|---|
| PubChem CID | 154717362 |
| Molecular Formula | C23H22ClN5O2 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | tert-butyl N-[2-(9-benzylpurin-6-yl)-5-chlorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)ccc1-c1ncnc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C23H22ClN5O2/c1-23(2,3)31-22(30)28-18-11-16(24)9-10-17(18)19-20-21(26-13-25-19)29(14-27-20)12-15-7-5-4-6-8-15/h4-11,13-14H,12H2,1-3H3,(H,28,30) |
| InChIKey | ICVKPGZAGLIWED-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |