C25H28N6O2 — CID 154716907
tert-butyl N-[2-(9-benzylpurin-6-yl)-5-(dimethylamino)phenyl]carbamate (PubChem CID 154716907) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is tert-butyl N-[2-(9-benzylpurin-6-yl)-5-(dimethylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-(9-benzylpurin-6-yl)-5-(dimethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 154716907 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | tert-butyl N-[2-(9-benzylpurin-6-yl)-5-(dimethylamino)phenyl]carbamate |
| SMILES | CN(C)c1ccc(-c2ncnc3c2ncn3Cc2ccccc2)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H28N6O2/c1-25(2,3)33-24(32)29-20-13-18(30(4)5)11-12-19(20)21-22-23(27-15-26-21)31(16-28-22)14-17-9-7-6-8-10-17/h6-13,15-16H,14H2,1-5H3,(H,29,32) |
| InChIKey | WULYSJCEPAYCAU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |