C22H28N6O4 — CID 11236024
benzyl (2S)-5-(6-aminopurin-9-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 11236024) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is benzyl (2S)-5-(6-aminopurin-9-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | benzyl (2S)-5-(6-aminopurin-9-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 11236024 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | benzyl (2S)-5-(6-aminopurin-9-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCn1cnc2c(N)ncnc21)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H28N6O4/c1-22(2,3)32-21(30)27-16(20(29)31-12-15-8-5-4-6-9-15)10-7-11-28-14-26-17-18(23)24-13-25-19(17)28/h4-6,8-9,13-14,16H,7,10-12H2,1-3H3,(H,27,30)(H2,23,24,25)/t16-/m0/s1 |
| InChIKey | GIEWWVDBGCBJEK-INIZCTEOSA-N |
| XLogP | 2.83 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |