C29H38N6O5 — CID 58166059
benzyl N-[(4S)-13-(6-aminopurin-9-yl)-7-ethyl-2-methyl-5,8,9-trioxotridecan-4-yl]carbamate (PubChem CID 58166059) has the molecular formula C29H38N6O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is benzyl N-[(4S)-13-(6-aminopurin-9-yl)-7-ethyl-2-methyl-5,8,9-trioxotridecan-4-yl]carbamate.
| Compound Name | benzyl N-[(4S)-13-(6-aminopurin-9-yl)-7-ethyl-2-methyl-5,8,9-trioxotridecan-4-yl]carbamate |
|---|---|
| PubChem CID | 58166059 |
| Molecular Formula | C29H38N6O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | benzyl N-[(4S)-13-(6-aminopurin-9-yl)-7-ethyl-2-methyl-5,8,9-trioxotridecan-4-yl]carbamate |
| SMILES | CCC(CC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)C(=O)C(=O)CCCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C29H38N6O5/c1-4-21(15-24(37)22(14-19(2)3)34-29(39)40-16-20-10-6-5-7-11-20)26(38)23(36)12-8-9-13-35-18-33-25-27(30)31-17-32-28(25)35/h5-7,10-11,17-19,21-22H,4,8-9,12-16H2,1-3H3,(H,34,39)(H2,30,31,32)/t21?,22-/m0/s1 |
| InChIKey | HRCUTFKOLGYFJU-KEKNWZKVSA-N |
| XLogP | 4.04 |
| TPSA | 159.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|