C23H27N9O4 — CID 101068711
(2S)-3-[[9-[4-(1H-imidazol-2-ylamino)butyl]purin-6-yl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 101068711) has the molecular formula C23H27N9O4 and a molecular weight of 493.53 g/mol. Its IUPAC name is (2S)-3-[[9-[4-(1H-imidazol-2-ylamino)butyl]purin-6-yl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-[[9-[4-(1H-imidazol-2-ylamino)butyl]purin-6-yl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 101068711 |
| Molecular Formula | C23H27N9O4 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | (2S)-3-[[9-[4-(1H-imidazol-2-ylamino)butyl]purin-6-yl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(N[C@@H](CNc1ncnc2c1ncn2CCCCNc1ncc[nH]1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C23H27N9O4/c33-21(34)17(31-23(35)36-13-16-6-2-1-3-7-16)12-27-19-18-20(29-14-28-19)32(15-30-18)11-5-4-8-24-22-25-9-10-26-22/h1-3,6-7,9-10,14-15,17H,4-5,8,11-13H2,(H,31,35)(H,33,34)(H2,24,25,26)(H,27,28,29)/t17-/m0/s1 |
| InChIKey | UHGZNADISFUWAU-KRWDZBQOSA-N |
| XLogP | 2.23 |
| TPSA | 171.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|