C23H23N5O2 — CID 134847294
tert-butyl N-[2-(9-benzylpurin-6-yl)phenyl]carbamate (PubChem CID 134847294) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is tert-butyl N-[2-(9-benzylpurin-6-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-(9-benzylpurin-6-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 134847294 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | tert-butyl N-[2-(9-benzylpurin-6-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1-c1ncnc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C23H23N5O2/c1-23(2,3)30-22(29)27-18-12-8-7-11-17(18)19-20-21(25-14-24-19)28(15-26-20)13-16-9-5-4-6-10-16/h4-12,14-15H,13H2,1-3H3,(H,27,29) |
| InChIKey | MQFJJSYQILOGBC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |