C23H29ClN4O4 — CID 22214968
[(3S)-3-[(6-chloropurin-9-yl)methoxy]-5-phenylmethoxypentyl] 2,2-dimethylpropanoate (PubChem CID 22214968) has the molecular formula C23H29ClN4O4 and a molecular weight of 460.96 g/mol. Its IUPAC name is [(3S)-3-[(6-chloropurin-9-yl)methoxy]-5-phenylmethoxypentyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S)-3-[(6-chloropurin-9-yl)methoxy]-5-phenylmethoxypentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22214968 |
| Molecular Formula | C23H29ClN4O4 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [(3S)-3-[(6-chloropurin-9-yl)methoxy]-5-phenylmethoxypentyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC[C@H](CCOCc1ccccc1)OCn1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C23H29ClN4O4/c1-23(2,3)22(29)31-12-10-18(9-11-30-13-17-7-5-4-6-8-17)32-16-28-15-27-19-20(24)25-14-26-21(19)28/h4-8,14-15,18H,9-13,16H2,1-3H3/t18-/m0/s1 |
| InChIKey | RIYPOPBVTNCLMB-SFHVURJKSA-N |
| XLogP | 4.41 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|