C21H34O6 — CID 126636545
[(3S)-3-(2-hydroxypropan-2-yloxy)-5-[(4-methoxyphenyl)methoxy]pentyl] 2,2-dimethylpropanoate (PubChem CID 126636545) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is [(3S)-3-(2-hydroxypropan-2-yloxy)-5-[(4-methoxyphenyl)methoxy]pentyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S)-3-(2-hydroxypropan-2-yloxy)-5-[(4-methoxyphenyl)methoxy]pentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 126636545 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | [(3S)-3-(2-hydroxypropan-2-yloxy)-5-[(4-methoxyphenyl)methoxy]pentyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(COCC[C@@H](CCOC(=O)C(C)(C)C)OC(C)(C)O)cc1 |
| InChI | InChI=1S/C21H34O6/c1-20(2,3)19(22)26-14-12-18(27-21(4,5)23)11-13-25-15-16-7-9-17(24-6)10-8-16/h7-10,18,23H,11-15H2,1-6H3/t18-/m0/s1 |
| InChIKey | NRPPLACDMPRFDX-SFHVURJKSA-N |
| XLogP | 3.69 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|