C18H28O4S — CID 578005
[3-hydroxy-5-[(4-methoxyphenyl)methylsulfanyl]pentyl] 2,2-dimethylpropanoate (PubChem CID 578005) has the molecular formula C18H28O4S and a molecular weight of 340.48 g/mol. Its IUPAC name is [3-hydroxy-5-[(4-methoxyphenyl)methylsulfanyl]pentyl] 2,2-dimethylpropanoate.
| Compound Name | [3-hydroxy-5-[(4-methoxyphenyl)methylsulfanyl]pentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 578005 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | [3-hydroxy-5-[(4-methoxyphenyl)methylsulfanyl]pentyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(CSCCC(O)CCOC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O4S/c1-18(2,3)17(20)22-11-9-15(19)10-12-23-13-14-5-7-16(21-4)8-6-14/h5-8,15,19H,9-13H2,1-4H3 |
| InChIKey | WYMCBHDEGSROCY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|