C16H23NO5S — CID 22800075
butoxycarbonyl (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]propanoate (PubChem CID 22800075) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is butoxycarbonyl (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]propanoate.
| Compound Name | butoxycarbonyl (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 22800075 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | butoxycarbonyl (2R)-2-amino-3-[(4-methoxyphenyl)methylsulfanyl]propanoate |
| SMILES | CCCCOC(=O)OC(=O)[C@@H](N)CSCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H23NO5S/c1-3-4-9-21-16(19)22-15(18)14(17)11-23-10-12-5-7-13(20-2)8-6-12/h5-8,14H,3-4,9-11,17H2,1-2H3/t14-/m0/s1 |
| InChIKey | IHLIWOQWTMKEOS-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|