C16H24ClNO3S — CID 59543105
[(2R)-2-(chloroamino)-3-[(4-methoxyphenyl)methylsulfanyl]propyl] 2,2-dimethylpropanoate (PubChem CID 59543105) has the molecular formula C16H24ClNO3S and a molecular weight of 345.89 g/mol. Its IUPAC name is [(2R)-2-(chloroamino)-3-[(4-methoxyphenyl)methylsulfanyl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-(chloroamino)-3-[(4-methoxyphenyl)methylsulfanyl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59543105 |
| Molecular Formula | C16H24ClNO3S |
| Molecular Weight | 345.89 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [(2R)-2-(chloroamino)-3-[(4-methoxyphenyl)methylsulfanyl]propyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(CSC[C@@H](COC(=O)C(C)(C)C)NCl)cc1 |
| InChI | InChI=1S/C16H24ClNO3S/c1-16(2,3)15(19)21-9-13(18-17)11-22-10-12-5-7-14(20-4)8-6-12/h5-8,13,18H,9-11H2,1-4H3/t13-/m1/s1 |
| InChIKey | GIDTZFMNEQJNBG-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.89 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|