C15H22ClNO3S — CID 59542951
ethyl (4R)-4-(chloroamino)-5-[(4-methoxyphenyl)methylsulfanyl]pentanoate (PubChem CID 59542951) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is ethyl (4R)-4-(chloroamino)-5-[(4-methoxyphenyl)methylsulfanyl]pentanoate.
| Compound Name | ethyl (4R)-4-(chloroamino)-5-[(4-methoxyphenyl)methylsulfanyl]pentanoate |
|---|---|
| PubChem CID | 59542951 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | ethyl (4R)-4-(chloroamino)-5-[(4-methoxyphenyl)methylsulfanyl]pentanoate |
| SMILES | CCOC(=O)CC[C@H](CSCc1ccc(OC)cc1)NCl |
| InChI | InChI=1S/C15H22ClNO3S/c1-3-20-15(18)9-6-13(17-16)11-21-10-12-4-7-14(19-2)8-5-12/h4-5,7-8,13,17H,3,6,9-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | OGTHLWSFIJSRHN-CYBMUJFWSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|