C19H30O3 — CID 11472279
ethyl 4-[2-(4-methoxyphenyl)ethyl]-6-methylheptanoate (PubChem CID 11472279) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is ethyl 4-[2-(4-methoxyphenyl)ethyl]-6-methylheptanoate.
| Compound Name | ethyl 4-[2-(4-methoxyphenyl)ethyl]-6-methylheptanoate |
|---|---|
| PubChem CID | 11472279 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | ethyl 4-[2-(4-methoxyphenyl)ethyl]-6-methylheptanoate |
| SMILES | CCOC(=O)CCC(CCc1ccc(OC)cc1)CC(C)C |
| InChI | InChI=1S/C19H30O3/c1-5-22-19(20)13-10-17(14-15(2)3)7-6-16-8-11-18(21-4)12-9-16/h8-9,11-12,15,17H,5-7,10,13-14H2,1-4H3 |
| InChIKey | CAFIXBNRZDMIRZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |