C8H16ClNO2S — CID 143825709
[(2R)-2-(chloroamino)-3-sulfanylpropyl] 2,2-dimethylpropanoate (PubChem CID 143825709) has the molecular formula C8H16ClNO2S and a molecular weight of 225.74 g/mol. Its IUPAC name is [(2R)-2-(chloroamino)-3-sulfanylpropyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-(chloroamino)-3-sulfanylpropyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 143825709 |
| Molecular Formula | C8H16ClNO2S |
| Molecular Weight | 225.74 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | [(2R)-2-(chloroamino)-3-sulfanylpropyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H](CS)NCl |
| InChI | InChI=1S/C8H16ClNO2S/c1-8(2,3)7(11)12-4-6(5-13)10-9/h6,10,13H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | AYZOOSWRDUPQJE-ZCFIWIBFSA-N |
| XLogP | 1.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.74 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|