C20H40N2O4 — CID 171348747
[(2S)-2-[2-[[(2S)-1-(2,2-dimethylpropanoyloxy)butan-2-yl]amino]ethylamino]butyl] 2,2-dimethylpropanoate (PubChem CID 171348747) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is [(2S)-2-[2-[[(2S)-1-(2,2-dimethylpropanoyloxy)butan-2-yl]amino]ethylamino]butyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-[2-[[(2S)-1-(2,2-dimethylpropanoyloxy)butan-2-yl]amino]ethylamino]butyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171348747 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | [(2S)-2-[2-[[(2S)-1-(2,2-dimethylpropanoyloxy)butan-2-yl]amino]ethylamino]butyl] 2,2-dimethylpropanoate |
| SMILES | CC[C@@H](COC(=O)C(C)(C)C)NCCN[C@@H](CC)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H40N2O4/c1-9-15(13-25-17(23)19(3,4)5)21-11-12-22-16(10-2)14-26-18(24)20(6,7)8/h15-16,21-22H,9-14H2,1-8H3/t15-,16-/m0/s1 |
| InChIKey | JZPTUWHARRWKQZ-HOTGVXAUSA-N |
| XLogP | 2.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|