C14H28O5 — CID 162953258
[(2S,3R,4R,5R)-3,4,5-trihydroxy-2,4-dimethylheptyl] 2,2-dimethylpropanoate (PubChem CID 162953258) has the molecular formula C14H28O5 and a molecular weight of 276.37 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3,4,5-trihydroxy-2,4-dimethylheptyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3R,4R,5R)-3,4,5-trihydroxy-2,4-dimethylheptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 162953258 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | [(2S,3R,4R,5R)-3,4,5-trihydroxy-2,4-dimethylheptyl] 2,2-dimethylpropanoate |
| SMILES | CC[C@@H](O)[C@@](C)(O)[C@H](O)[C@@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H28O5/c1-7-10(15)14(6,18)11(16)9(2)8-19-12(17)13(3,4)5/h9-11,15-16,18H,7-8H2,1-6H3/t9-,10+,11+,14+/m0/s1 |
| InChIKey | PIQOUSUBXZWSBG-ICUOPCATSA-N |
| XLogP | 1.09 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |