C20H43NO3 — CID 87633887
N,N-dibutylbutan-1-amine;2-hydroxypropyl 2,2-dimethylpropanoate (PubChem CID 87633887) has the molecular formula C20H43NO3 and a molecular weight of 345.57 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;2-hydroxypropyl 2,2-dimethylpropanoate.
| Compound Name | N,N-dibutylbutan-1-amine;2-hydroxypropyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87633887 |
| Molecular Formula | C20H43NO3 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.32 |
| IUPAC Name | N,N-dibutylbutan-1-amine;2-hydroxypropyl 2,2-dimethylpropanoate |
| SMILES | CC(O)COC(=O)C(C)(C)C.CCCCN(CCCC)CCCC |
| InChI | InChI=1S/C12H27N.C8H16O3/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-6(9)5-11-7(10)8(2,3)4/h4-12H2,1-3H3;6,9H,5H2,1-4H3 |
| InChIKey | KRBSRHINTBFZEN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |