C15H30O3 — CID 10244256
[(2R,3S)-2-hydroxy-3-propylheptyl] 2,2-dimethylpropanoate (PubChem CID 10244256) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is [(2R,3S)-2-hydroxy-3-propylheptyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S)-2-hydroxy-3-propylheptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10244256 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | [(2R,3S)-2-hydroxy-3-propylheptyl] 2,2-dimethylpropanoate |
| SMILES | CCCC[C@H](CCC)[C@@H](O)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H30O3/c1-6-8-10-12(9-7-2)13(16)11-18-14(17)15(3,4)5/h12-13,16H,6-11H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | GCJBBYVWPRKIBL-STQMWFEESA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |