C18H37NO2 — CID 144974044
2-(dibutylamino)ethyl 2-ethyl-2,3-dimethylbutanoate (PubChem CID 144974044) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is 2-(dibutylamino)ethyl 2-ethyl-2,3-dimethylbutanoate.
| Compound Name | 2-(dibutylamino)ethyl 2-ethyl-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 144974044 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 2-(dibutylamino)ethyl 2-ethyl-2,3-dimethylbutanoate |
| SMILES | CCCCN(CCCC)CCOC(=O)C(C)(CC)C(C)C |
| InChI | InChI=1S/C18H37NO2/c1-7-10-12-19(13-11-8-2)14-15-21-17(20)18(6,9-3)16(4)5/h16H,7-15H2,1-6H3 |
| InChIKey | HBPIEQNMKKLJKL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |