About 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane
2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane (PubChem CID 142590782) has the molecular formula C20H43NO2
and a molecular weight of 329.57 g/mol. Its IUPAC name is 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane.
Molecular Properties
| Compound Name | 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane |
| PubChem CID | 142590782 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane |
| SMILES | CC.CCCC(C)(C(=O)OCCN(C(C)C)C(C)C)C(C)CC |
| InChI | InChI=1S/C18H37NO2.C2H6/c1-9-11-18(8,16(7)10-2)17(20)21-13-12-19(14(3)4)15(5)6;1-2/h14-16H,9-13H2,1-8H3;1-2H3 |
| InChIKey | LMVVJJSKLZKLTN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane?
The IUPAC name of 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane (CID 142590782) is 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane.
What is the SMILES notation for 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane?
The canonical SMILES for 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane is CC.CCCC(C)(C(=O)OCCN(C(C)C)C(C)C)C(C)CC.
What is the InChIKey of 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane?
The InChIKey is LMVVJJSKLZKLTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2.C2H6/c1-9-11-18(8,16(7)10-2)17(20)21-13-12-19(14(3)4)15(5)6;1-2/h14-16H,9-13H2,1-8H3;1-2H3.
What are the key properties of 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane?
2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane has a molecular weight of 329.57 g/mol, XLogP of 5.53, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[di(propan-2-yl)amino]ethyl 2,3-dimethyl-2-propylpentanoate;ethane is sourced from PubChem (CID 142590782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).