About 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate
2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate (PubChem CID 142030334) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate |
| PubChem CID | 142030334 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate |
| SMILES | CCCCC(C)(CCC)C(=O)OCCN(C)C |
| InChI | InChI=1S/C14H29NO2/c1-6-8-10-14(3,9-7-2)13(16)17-12-11-15(4)5/h6-12H2,1-5H3 |
| InChIKey | MAZUSGFPJPLHHT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate?
The IUPAC name of 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate (CID 142030334) is 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate is CCCCC(C)(CCC)C(=O)OCCN(C)C.
What is the InChIKey of 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate?
The InChIKey is MAZUSGFPJPLHHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-6-8-10-14(3,9-7-2)13(16)17-12-11-15(4)5/h6-12H2,1-5H3.
What are the key properties of 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate?
2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate has a molecular weight of 243.39 g/mol, XLogP of 3.09, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-methyl-2-propylhexanoate is sourced from PubChem (CID 142030334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).