C74H149NO2 — CID 59456217
2-(dimethylamino)ethyl 4,4-bis[2,2-bis(2,2-diethylbutyl)-4,4-diethylhexyl]-2,6,6-triethyl-2-methylundecanoate (PubChem CID 59456217) has the molecular formula C74H149NO2 and a molecular weight of 1085.01 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4,4-bis[2,2-bis(2,2-diethylbutyl)-4,4-diethylhexyl]-2,6,6-triethyl-2-methylundecanoate.
| Compound Name | 2-(dimethylamino)ethyl 4,4-bis[2,2-bis(2,2-diethylbutyl)-4,4-diethylhexyl]-2,6,6-triethyl-2-methylundecanoate |
|---|---|
| PubChem CID | 59456217 |
| Molecular Formula | C74H149NO2 |
| Molecular Weight | 1085.01 g/mol |
| Exact Mass | 1084.16 |
| IUPAC Name | 2-(dimethylamino)ethyl 4,4-bis[2,2-bis(2,2-diethylbutyl)-4,4-diethylhexyl]-2,6,6-triethyl-2-methylundecanoate |
| SMILES | CCCCCC(CC)(CC)CC(CC(CC(CC)(CC)CC)(CC(CC)(CC)CC)CC(CC)(CC)CC)(CC(CC(CC)(CC)CC)(CC(CC)(CC)CC)CC(CC)(CC)CC)CC(C)(CC)C(=O)OCCN(C)C |
| InChI | InChI=1S/C74H149NO2/c1-26-48-49-50-71(46-21,47-22)60-72(53-64(23,27-2)63(76)77-52-51-75(24)25,61-73(54-65(28-3,29-4)30-5,55-66(31-6,32-7)33-8)56-67(34-9,35-10)36-11)62-74(57-68(37-12,38-13)39-14,58-69(40-15,41-16)42-17)59-70(43-18,44-19)45-20/h26-62H2,1-25H3 |
| InChIKey | RZAWVQNUONBTBB-UHFFFAOYSA-N |
| XLogP | 25.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1085.01 |
| LogP ≤ 5 | 25.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|