C22H37NO6 — CID 170522359
CID 170522359 (PubChem CID 170522359) has the molecular formula C22H37NO6 and a molecular weight of 411.54 g/mol.
| Compound Name | CID 170522359 |
|---|---|
| PubChem CID | 170522359 |
| Molecular Formula | C22H37NO6 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | — |
| SMILES | [CH]C(C)(CC(C)(CC([CH])(C)C(=O)OCCN(C)C)C(=O)OCCCC)C(=O)OC |
| InChI | InChI=1S/C22H37NO6/c1-10-11-13-28-19(26)22(6,15-20(2,3)17(24)27-9)16-21(4,5)18(25)29-14-12-23(7)8/h2,4H,10-16H2,1,3,5-9H3 |
| InChIKey | OUPBDXZRZUKROJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|