C44H78N2O11 — CID 163413652
4-butoxycarbonyl-12-cyano-6-[2-(dimethylamino)ethoxycarbonyl]-8-hexoxycarbonyl-10-(2-methoxyethoxycarbonyl)-2,4,6,8,10,12-hexamethyl-2-propyltridecanoic acid (PubChem CID 163413652) has the molecular formula C44H78N2O11 and a molecular weight of 811.11 g/mol. Its IUPAC name is 4-butoxycarbonyl-12-cyano-6-[2-(dimethylamino)ethoxycarbonyl]-8-hexoxycarbonyl-10-(2-methoxyethoxycarbonyl)-2,4,6,8,10,12-hexamethyl-2-propyltridecanoic acid.
| Compound Name | 4-butoxycarbonyl-12-cyano-6-[2-(dimethylamino)ethoxycarbonyl]-8-hexoxycarbonyl-10-(2-methoxyethoxycarbonyl)-2,4,6,8,10,12-hexamethyl-2-propyltridecanoic acid |
|---|---|
| PubChem CID | 163413652 |
| Molecular Formula | C44H78N2O11 |
| Molecular Weight | 811.11 g/mol |
| Exact Mass | 810.56 |
| IUPAC Name | 4-butoxycarbonyl-12-cyano-6-[2-(dimethylamino)ethoxycarbonyl]-8-hexoxycarbonyl-10-(2-methoxyethoxycarbonyl)-2,4,6,8,10,12-hexamethyl-2-propyltridecanoic acid |
| SMILES | CCCCCCOC(=O)C(C)(CC(C)(CC(C)(C)C#N)C(=O)OCCOC)CC(C)(CC(C)(CC(C)(CCC)C(=O)O)C(=O)OCCCC)C(=O)OCCN(C)C |
| InChI | InChI=1S/C44H78N2O11/c1-14-17-19-20-24-55-37(51)43(9,30-41(7,28-39(4,5)33-45)35(49)57-27-26-53-13)32-44(10,38(52)56-25-22-46(11)12)31-42(8,36(50)54-23-18-15-2)29-40(6,21-16-3)34(47)48/h14-32H2,1-13H3,(H,47,48) |
| InChIKey | OPKJFNKHTUCRTK-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 178.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.11 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|