C45H80N2O11 — CID 162711214
4-butoxycarbonyl-12-cyano-6-[2-(dimethylamino)ethoxycarbonyl]-8-hexoxycarbonyl-10-(2-methoxyethoxycarbonyl)-4,6,7,8,10,12-hexamethyl-2-propyltetradecanoic acid (PubChem CID 162711214) has the molecular formula C45H80N2O11 and a molecular weight of 825.14 g/mol. Its IUPAC name is 4-butoxycarbonyl-12-cyano-6-[2-(dimethylamino)ethoxycarbonyl]-8-hexoxycarbonyl-10-(2-methoxyethoxycarbonyl)-4,6,7,8,10,12-hexamethyl-2-propyltetradecanoic acid.
| Compound Name | 4-butoxycarbonyl-12-cyano-6-[2-(dimethylamino)ethoxycarbonyl]-8-hexoxycarbonyl-10-(2-methoxyethoxycarbonyl)-4,6,7,8,10,12-hexamethyl-2-propyltetradecanoic acid |
|---|---|
| PubChem CID | 162711214 |
| Molecular Formula | C45H80N2O11 |
| Molecular Weight | 825.14 g/mol |
| Exact Mass | 824.58 |
| IUPAC Name | 4-butoxycarbonyl-12-cyano-6-[2-(dimethylamino)ethoxycarbonyl]-8-hexoxycarbonyl-10-(2-methoxyethoxycarbonyl)-4,6,7,8,10,12-hexamethyl-2-propyltetradecanoic acid |
| SMILES | CCCCCCOC(=O)C(C)(CC(C)(CC(C)(C#N)CC)C(=O)OCCOC)C(C)C(C)(CC(C)(CC(CCC)C(=O)O)C(=O)OCCCC)C(=O)OCCN(C)C |
| InChI | InChI=1S/C45H80N2O11/c1-14-18-20-21-25-56-39(52)45(10,32-43(8,30-41(6,17-4)33-46)38(51)58-28-27-54-13)34(5)44(9,40(53)57-26-23-47(11)12)31-42(7,37(50)55-24-19-15-2)29-35(22-16-3)36(48)49/h34-35H,14-32H2,1-13H3,(H,48,49) |
| InChIKey | DXCOAQDHWMKBKV-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 178.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.14 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|