C26H49NO6 — CID 158032758
2-(4-butoxy-3,3-dimethyl-4-oxobutyl)-5-[2-(dimethylamino)ethoxycarbonyl]-5-methyl-2-propylheptanoic acid (PubChem CID 158032758) has the molecular formula C26H49NO6 and a molecular weight of 471.68 g/mol. Its IUPAC name is 2-(4-butoxy-3,3-dimethyl-4-oxobutyl)-5-[2-(dimethylamino)ethoxycarbonyl]-5-methyl-2-propylheptanoic acid.
| Compound Name | 2-(4-butoxy-3,3-dimethyl-4-oxobutyl)-5-[2-(dimethylamino)ethoxycarbonyl]-5-methyl-2-propylheptanoic acid |
|---|---|
| PubChem CID | 158032758 |
| Molecular Formula | C26H49NO6 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.36 |
| IUPAC Name | 2-(4-butoxy-3,3-dimethyl-4-oxobutyl)-5-[2-(dimethylamino)ethoxycarbonyl]-5-methyl-2-propylheptanoic acid |
| SMILES | CCCCOC(=O)C(C)(C)CCC(CCC)(CCC(C)(CC)C(=O)OCCN(C)C)C(=O)O |
| InChI | InChI=1S/C26H49NO6/c1-9-12-19-32-22(30)24(4,5)14-16-26(13-10-2,21(28)29)17-15-25(6,11-3)23(31)33-20-18-27(7)8/h9-20H2,1-8H3,(H,28,29) |
| InChIKey | FHJLACBZYFDELM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|