C33H61NO10 — CID 58301351
2-(3-butoxy-2,2-dimethyl-3-oxopropyl)-4-[2-(dimethylamino)ethoxycarbonyl]-6-(2-ethoxyethoxymethoxycarbonyl)-4,6-dimethyl-2-propyloctanoic acid (PubChem CID 58301351) has the molecular formula C33H61NO10 and a molecular weight of 631.85 g/mol. Its IUPAC name is 2-(3-butoxy-2,2-dimethyl-3-oxopropyl)-4-[2-(dimethylamino)ethoxycarbonyl]-6-(2-ethoxyethoxymethoxycarbonyl)-4,6-dimethyl-2-propyloctanoic acid.
| Compound Name | 2-(3-butoxy-2,2-dimethyl-3-oxopropyl)-4-[2-(dimethylamino)ethoxycarbonyl]-6-(2-ethoxyethoxymethoxycarbonyl)-4,6-dimethyl-2-propyloctanoic acid |
|---|---|
| PubChem CID | 58301351 |
| Molecular Formula | C33H61NO10 |
| Molecular Weight | 631.85 g/mol |
| Exact Mass | 631.43 |
| IUPAC Name | 2-(3-butoxy-2,2-dimethyl-3-oxopropyl)-4-[2-(dimethylamino)ethoxycarbonyl]-6-(2-ethoxyethoxymethoxycarbonyl)-4,6-dimethyl-2-propyloctanoic acid |
| SMILES | CCCCOC(=O)C(C)(C)CC(CCC)(CC(C)(CC(C)(CC)C(=O)OCOCCOCC)C(=O)OCCN(C)C)C(=O)O |
| InChI | InChI=1S/C33H61NO10/c1-11-15-18-42-27(37)30(5,6)22-33(16-12-2,26(35)36)24-32(8,29(39)43-19-17-34(9)10)23-31(7,13-3)28(38)44-25-41-21-20-40-14-4/h11-25H2,1-10H3,(H,35,36) |
| InChIKey | XJUAAQAKNDFCEY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.85 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|