C23H46O2 — CID 174550479
ethyl 2,3,13-trimethyl-2-propylpentadecanoate (PubChem CID 174550479) has the molecular formula C23H46O2 and a molecular weight of 354.62 g/mol. Its IUPAC name is ethyl 2,3,13-trimethyl-2-propylpentadecanoate.
| Compound Name | ethyl 2,3,13-trimethyl-2-propylpentadecanoate |
|---|---|
| PubChem CID | 174550479 |
| Molecular Formula | C23H46O2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | ethyl 2,3,13-trimethyl-2-propylpentadecanoate |
| SMILES | CCCC(C)(C(=O)OCC)C(C)CCCCCCCCCC(C)CC |
| InChI | InChI=1S/C23H46O2/c1-7-19-23(6,22(24)25-9-3)21(5)18-16-14-12-10-11-13-15-17-20(4)8-2/h20-21H,7-19H2,1-6H3 |
| InChIKey | RIKWWPSAMFDMCV-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|