C16H35NO2 — CID 174805444
azane;propyl 3-methyl-2,2-dipropylhexanoate (PubChem CID 174805444) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is azane;propyl 3-methyl-2,2-dipropylhexanoate.
| Compound Name | azane;propyl 3-methyl-2,2-dipropylhexanoate |
|---|---|
| PubChem CID | 174805444 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | azane;propyl 3-methyl-2,2-dipropylhexanoate |
| SMILES | CCCOC(=O)C(CCC)(CCC)C(C)CCC.N |
| InChI | InChI=1S/C16H32O2.H3N/c1-6-10-14(5)16(11-7-2,12-8-3)15(17)18-13-9-4;/h14H,6-13H2,1-5H3;1H3 |
| InChIKey | MSVCEJQTUOHQHU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |