About 1-O-ethyl 3-O-propyl 2-propylpropanedioate
1-O-ethyl 3-O-propyl 2-propylpropanedioate (PubChem CID 175366314) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-O-ethyl 3-O-propyl 2-propylpropanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-propyl 2-propylpropanedioate |
| PubChem CID | 175366314 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-O-ethyl 3-O-propyl 2-propylpropanedioate |
| SMILES | CCCOC(=O)C(CCC)C(=O)OCC |
| InChI | InChI=1S/C11H20O4/c1-4-7-9(10(12)14-6-3)11(13)15-8-5-2/h9H,4-8H2,1-3H3 |
| InChIKey | RGDRVZUPXURFRF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-propyl 2-propylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-propyl 2-propylpropanedioate?
The IUPAC name of 1-O-ethyl 3-O-propyl 2-propylpropanedioate (CID 175366314) is 1-O-ethyl 3-O-propyl 2-propylpropanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-propyl 2-propylpropanedioate?
The canonical SMILES for 1-O-ethyl 3-O-propyl 2-propylpropanedioate is CCCOC(=O)C(CCC)C(=O)OCC.
What is the InChIKey of 1-O-ethyl 3-O-propyl 2-propylpropanedioate?
The InChIKey is RGDRVZUPXURFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-4-7-9(10(12)14-6-3)11(13)15-8-5-2/h9H,4-8H2,1-3H3.
What are the key properties of 1-O-ethyl 3-O-propyl 2-propylpropanedioate?
1-O-ethyl 3-O-propyl 2-propylpropanedioate has a molecular weight of 216.28 g/mol, XLogP of 1.92, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-propyl 2-propylpropanedioate is sourced from PubChem (CID 175366314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).