About 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate
2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate (PubChem CID 166505142) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate.
Molecular Properties
| Compound Name | 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate |
| PubChem CID | 166505142 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate |
| SMILES | CCC(C)CC(C)C(C)COC(=O)C(C)(C)O |
| InChI | InChI=1S/C14H28O3/c1-7-10(2)8-11(3)12(4)9-17-13(15)14(5,6)16/h10-12,16H,7-9H2,1-6H3 |
| InChIKey | CHRYLNKCRBMHAX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate?
The IUPAC name of 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate (CID 166505142) is 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate.
What is the SMILES notation for 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate?
The canonical SMILES for 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate is CCC(C)CC(C)C(C)COC(=O)C(C)(C)O.
What is the InChIKey of 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate?
The InChIKey is CHRYLNKCRBMHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3/c1-7-10(2)8-11(3)12(4)9-17-13(15)14(5,6)16/h10-12,16H,7-9H2,1-6H3.
What are the key properties of 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate?
2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate has a molecular weight of 244.37 g/mol, XLogP of 3.01, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trimethylheptyl 2-hydroxy-2-methylpropanoate is sourced from PubChem (CID 166505142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).